C15H17FO3 — CID 171947307
(5-fluoro-2-methoxyphenyl)-(8-oxabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 171947307) has the molecular formula C15H17FO3 and a molecular weight of 264.30 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)-(8-oxabicyclo[3.2.1]octan-3-yl)methanone.
| Compound Name | (5-fluoro-2-methoxyphenyl)-(8-oxabicyclo[3.2.1]octan-3-yl)methanone |
|---|---|
| PubChem CID | 171947307 |
| Molecular Formula | C15H17FO3 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)-(8-oxabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | COc1ccc(F)cc1C(=O)C1CC2CCC(C1)O2 |
| InChI | InChI=1S/C15H17FO3/c1-18-14-5-2-10(16)8-13(14)15(17)9-6-11-3-4-12(7-9)19-11/h2,5,8-9,11-12H,3-4,6-7H2,1H3 |
| InChIKey | YWJJLQBQOQTFGC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |