C16H18F3NO3 — CID 171949229
(9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-[3-(trifluoromethoxy)phenyl]methanone (PubChem CID 171949229) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-[3-(trifluoromethoxy)phenyl]methanone.
| Compound Name | (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-[3-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 171949229 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (9-methyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-[3-(trifluoromethoxy)phenyl]methanone |
| SMILES | CN1C2COCC1CC(C(=O)c1cccc(OC(F)(F)F)c1)C2 |
| InChI | InChI=1S/C16H18F3NO3/c1-20-12-5-11(6-13(20)9-22-8-12)15(21)10-3-2-4-14(7-10)23-16(17,18)19/h2-4,7,11-13H,5-6,8-9H2,1H3 |
| InChIKey | LWSLTSCABNQOQL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |