About [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone
[2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171949427) has the molecular formula C18H24O5S
and a molecular weight of 352.45 g/mol. Its IUPAC name is [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone.
Molecular Properties
| Compound Name | [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| PubChem CID | 171949427 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | COC(OC)c1ccccc1C(=O)C1CC2CCCC(C1)S2(=O)=O |
| InChI | InChI=1S/C18H24O5S/c1-22-18(23-2)16-9-4-3-8-15(16)17(19)12-10-13-6-5-7-14(11-12)24(13,20)21/h3-4,8-9,12-14,18H,5-7,10-11H2,1-2H3 |
| InChIKey | SEKDCZKRBQZEQE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The IUPAC name of [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone (CID 171949427) is [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone.
What is the SMILES notation for [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The canonical SMILES for [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone is COC(OC)c1ccccc1C(=O)C1CC2CCCC(C1)S2(=O)=O.
What is the InChIKey of [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The InChIKey is SEKDCZKRBQZEQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O5S/c1-22-18(23-2)16-9-4-3-8-15(16)17(19)12-10-13-6-5-7-14(11-12)24(13,20)21/h3-4,8-9,12-14,18H,5-7,10-11H2,1-2H3.
What are the key properties of [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone?
[2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone has a molecular weight of 352.45 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dimethoxymethyl)phenyl]-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)methanone is sourced from PubChem (CID 171949427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).