About (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone
(2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 171949693) has the molecular formula C19H26O3S
and a molecular weight of 334.48 g/mol. Its IUPAC name is (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone.
Molecular Properties
| Compound Name | (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone |
| PubChem CID | 171949693 |
| Molecular Formula | C19H26O3S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | CCc1cc(C)cc(CC)c1C(=O)C1CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C19H26O3S/c1-4-13-8-12(3)9-14(5-2)18(13)19(20)15-10-16-6-7-17(11-15)23(16,21)22/h8-9,15-17H,4-7,10-11H2,1-3H3 |
| InChIKey | KGCUTCBBTADIEK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone?
The IUPAC name of (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone (CID 171949693) is (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone.
What is the SMILES notation for (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone?
The canonical SMILES for (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone is CCc1cc(C)cc(CC)c1C(=O)C1CC2CCC(C1)S2(=O)=O.
What is the InChIKey of (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone?
The InChIKey is KGCUTCBBTADIEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O3S/c1-4-13-8-12(3)9-14(5-2)18(13)19(20)15-10-16-6-7-17(11-15)23(16,21)22/h8-9,15-17H,4-7,10-11H2,1-3H3.
What are the key properties of (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone?
(2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone has a molecular weight of 334.48 g/mol, XLogP of 3.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-diethyl-4-methylphenyl)-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)methanone is sourced from PubChem (CID 171949693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).