C20H35NO3 — CID 171950084
tert-butyl 3-octanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171950084) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is tert-butyl 3-octanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-octanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171950084 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | tert-butyl 3-octanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCCCCCCC(=O)C1CC2CCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H35NO3/c1-5-6-7-8-9-10-18(22)15-13-16-11-12-17(14-15)21(16)19(23)24-20(2,3)4/h15-17H,5-14H2,1-4H3 |
| InChIKey | DFDMBAJTMWPSIU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|