C23H24FNO3 — CID 171950949
benzyl 3-(2-fluorobenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171950949) has the molecular formula C23H24FNO3 and a molecular weight of 381.45 g/mol. Its IUPAC name is benzyl 3-(2-fluorobenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 3-(2-fluorobenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171950949 |
| Molecular Formula | C23H24FNO3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | benzyl 3-(2-fluorobenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | O=C(c1ccccc1F)C1CC2CCCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H24FNO3/c24-21-12-5-4-11-20(21)22(26)17-13-18-9-6-10-19(14-17)25(18)23(27)28-15-16-7-2-1-3-8-16/h1-5,7-8,11-12,17-19H,6,9-10,13-15H2 |
| InChIKey | VOFUGUFIRINPID-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |