About 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one
2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one (PubChem CID 171951010) has the molecular formula C8H11FO3S
and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one.
Analyze 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one?
The IUPAC name of 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one (CID 171951010) is 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one.
What is the SMILES notation for 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one?
The canonical SMILES for 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one is O=C1CC2CCCC(C1F)S2(=O)=O.
What is the InChIKey of 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one?
The InChIKey is FOHBVFSCBPJKGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FO3S/c9-8-6(10)4-5-2-1-3-7(8)13(5,11)12/h5,7-8H,1-4H2.
What are the key properties of 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one?
2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one has a molecular weight of 206.24 g/mol, XLogP of 0.63, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one is sourced from PubChem (CID 171951010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).