About 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one
2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one (PubChem CID 171951010) has the molecular formula C8H11FO3S
and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one.
Molecular Properties
| Compound Name | 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one |
| PubChem CID | 171951010 |
| Molecular Formula | C8H11FO3S |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one |
| SMILES | O=C1CC2CCCC(C1F)S2(=O)=O |
| InChI | InChI=1S/C8H11FO3S/c9-8-6(10)4-5-2-1-3-7(8)13(5,11)12/h5,7-8H,1-4H2 |
| InChIKey | FOHBVFSCBPJKGE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one?
The IUPAC name of 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one (CID 171951010) is 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one.
What is the SMILES notation for 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one?
The canonical SMILES for 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one is O=C1CC2CCCC(C1F)S2(=O)=O.
What is the InChIKey of 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one?
The InChIKey is FOHBVFSCBPJKGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FO3S/c9-8-6(10)4-5-2-1-3-7(8)13(5,11)12/h5,7-8H,1-4H2.
What are the key properties of 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one?
2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one has a molecular weight of 206.24 g/mol, XLogP of 0.63, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-one is sourced from PubChem (CID 171951010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).