About 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol
8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171951290) has the molecular formula C8H11F3O3S
and a molecular weight of 244.23 g/mol. Its IUPAC name is 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 171951290 |
| Molecular Formula | C8H11F3O3S |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1(=O)C2CCC1CC(O)(C(F)(F)F)C2 |
| InChI | InChI=1S/C8H11F3O3S/c9-8(10,11)7(12)3-5-1-2-6(4-7)15(5,13)14/h5-6,12H,1-4H2 |
| InChIKey | YKDMUJZWYOEWFE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol (CID 171951290) is 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol is O=S1(=O)C2CCC1CC(O)(C(F)(F)F)C2.
What is the InChIKey of 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The InChIKey is YKDMUJZWYOEWFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3O3S/c9-8(10,11)7(12)3-5-1-2-6(4-7)15(5,13)14/h5-6,12H,1-4H2.
What are the key properties of 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol?
8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol has a molecular weight of 244.23 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dioxo-3-(trifluoromethyl)-8λ6-thiabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 171951290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).