About (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate
(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate (PubChem CID 171951387) has the molecular formula C9H11F3O4S2
and a molecular weight of 304.31 g/mol. Its IUPAC name is (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate |
| PubChem CID | 171951387 |
| Molecular Formula | C9H11F3O4S2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate |
| SMILES | O=S1C2C=C(OS(=O)(=O)C(F)(F)F)CC1CCC2 |
| InChI | InChI=1S/C9H11F3O4S2/c10-9(11,12)18(14,15)16-6-4-7-2-1-3-8(5-6)17(7)13/h4,7-8H,1-3,5H2 |
| InChIKey | CZOWRZVIOQEBDE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate?
The IUPAC name of (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate (CID 171951387) is (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate.
What is the SMILES notation for (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate?
The canonical SMILES for (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate is O=S1C2C=C(OS(=O)(=O)C(F)(F)F)CC1CCC2.
What is the InChIKey of (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate?
The InChIKey is CZOWRZVIOQEBDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3O4S2/c10-9(11,12)18(14,15)16-6-4-7-2-1-3-8(5-6)17(7)13/h4,7-8H,1-3,5H2.
What are the key properties of (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate?
(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate has a molecular weight of 304.31 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl) trifluoromethanesulfonate is sourced from PubChem (CID 171951387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).