C12H18O4S — CID 171951483
methyl 3-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ylidene)propanoate (PubChem CID 171951483) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is methyl 3-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ylidene)propanoate.
| Compound Name | methyl 3-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ylidene)propanoate |
|---|---|
| PubChem CID | 171951483 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | methyl 3-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ylidene)propanoate |
| SMILES | COC(=O)CC=C1CC2CCCC(C1)S2(=O)=O |
| InChI | InChI=1S/C12H18O4S/c1-16-12(13)6-5-9-7-10-3-2-4-11(8-9)17(10,14)15/h5,10-11H,2-4,6-8H2,1H3 |
| InChIKey | NDZLEIOHAMENRZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|