About 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol
7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol (PubChem CID 171951927) has the molecular formula C11H19NO4
and a molecular weight of 229.28 g/mol. Its IUPAC name is 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol.
Molecular Properties
| Compound Name | 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
| PubChem CID | 171951927 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
| SMILES | OC1(CC2OCCO2)CC2COCC(C1)N2 |
| InChI | InChI=1S/C11H19NO4/c13-11(5-10-15-1-2-16-10)3-8-6-14-7-9(4-11)12-8/h8-10,12-13H,1-7H2 |
| InChIKey | GZMJRTIKKYTHSS-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol?
The IUPAC name of 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol (CID 171951927) is 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol.
What is the SMILES notation for 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol?
The canonical SMILES for 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol is OC1(CC2OCCO2)CC2COCC(C1)N2.
What is the InChIKey of 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol?
The InChIKey is GZMJRTIKKYTHSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO4/c13-11(5-10-15-1-2-16-10)3-8-6-14-7-9(4-11)12-8/h8-10,12-13H,1-7H2.
What are the key properties of 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol?
7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol has a molecular weight of 229.28 g/mol, XLogP of -0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,3-dioxolan-2-ylmethyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol is sourced from PubChem (CID 171951927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).