About 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol
8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171952301) has the molecular formula C10H13F3O2S
and a molecular weight of 254.27 g/mol. Its IUPAC name is 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 171952301 |
| Molecular Formula | C10H13F3O2S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | C=C(C(F)(F)F)C1(O)CC2CCC(C1)S2=O |
| InChI | InChI=1S/C10H13F3O2S/c1-6(10(11,12)13)9(14)4-7-2-3-8(5-9)16(7)15/h7-8,14H,1-5H2 |
| InChIKey | FBNUAQJHCPWBBN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol (CID 171952301) is 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol is C=C(C(F)(F)F)C1(O)CC2CCC(C1)S2=O.
What is the InChIKey of 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The InChIKey is FBNUAQJHCPWBBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3O2S/c1-6(10(11,12)13)9(14)4-7-2-3-8(5-9)16(7)15/h7-8,14H,1-5H2.
What are the key properties of 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol has a molecular weight of 254.27 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxo-3-(3,3,3-trifluoroprop-1-en-2-yl)-8λ4-thiabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 171952301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).