About 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol
3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171952495) has the molecular formula C11H18O2S
and a molecular weight of 214.33 g/mol. Its IUPAC name is 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 171952495 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | CC=C(C)C1(O)CC2CCC(C1)S2=O |
| InChI | InChI=1S/C11H18O2S/c1-3-8(2)11(12)6-9-4-5-10(7-11)14(9)13/h3,9-10,12H,4-7H2,1-2H3 |
| InChIKey | YINPUHQTEFMVHF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol (CID 171952495) is 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol is CC=C(C)C1(O)CC2CCC(C1)S2=O.
What is the InChIKey of 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The InChIKey is YINPUHQTEFMVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2S/c1-3-8(2)11(12)6-9-4-5-10(7-11)14(9)13/h3,9-10,12H,4-7H2,1-2H3.
What are the key properties of 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol?
3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol has a molecular weight of 214.33 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-2-en-2-yl-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 171952495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).