About 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol
3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171952931) has the molecular formula C11H19FO3S
and a molecular weight of 250.33 g/mol. Its IUPAC name is 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 171952931 |
| Molecular Formula | C11H19FO3S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1(=O)C2CCC1CC(O)(CCCCF)C2 |
| InChI | InChI=1S/C11H19FO3S/c12-6-2-1-5-11(13)7-9-3-4-10(8-11)16(9,14)15/h9-10,13H,1-8H2 |
| InChIKey | PSUMMMCFFLQIGC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol (CID 171952931) is 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol is O=S1(=O)C2CCC1CC(O)(CCCCF)C2.
What is the InChIKey of 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The InChIKey is PSUMMMCFFLQIGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FO3S/c12-6-2-1-5-11(13)7-9-3-4-10(8-11)16(9,14)15/h9-10,13H,1-8H2.
What are the key properties of 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol has a molecular weight of 250.33 g/mol, XLogP of 1.60, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorobutyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 171952931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).