C10H14O3S — CID 171953177
8,8-dioxo-3-prop-2-ynyl-8λ6-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171953177) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 8,8-dioxo-3-prop-2-ynyl-8λ6-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8,8-dioxo-3-prop-2-ynyl-8λ6-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171953177 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 8,8-dioxo-3-prop-2-ynyl-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | C#CCC1(O)CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C10H14O3S/c1-2-5-10(11)6-8-3-4-9(7-10)14(8,12)13/h1,8-9,11H,3-7H2 |
| InChIKey | VWTDHRZAUUTJFV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|