C11H19NO — CID 171953194
8-methyl-3-[(Z)-prop-1-enyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171953194) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 8-methyl-3-[(Z)-prop-1-enyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-methyl-3-[(Z)-prop-1-enyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171953194 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 8-methyl-3-[(Z)-prop-1-enyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | C/C=C\C1(O)CC2CCC(C1)N2C |
| InChI | InChI=1S/C11H19NO/c1-3-6-11(13)7-9-4-5-10(8-11)12(9)2/h3,6,9-10,13H,4-5,7-8H2,1-2H3/b6-3- |
| InChIKey | SWKUBGBGMMXBTJ-UTCJRWHESA-N |
| XLogP | 1.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|