C33H37BN2O6 — CID 171953588
9H-fluoren-9-ylmethyl 7-hydroxy-7-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171953588) has the molecular formula C33H37BN2O6 and a molecular weight of 568.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 7-hydroxy-7-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 7-hydroxy-7-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171953588 |
| Molecular Formula | C33H37BN2O6 |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 7-hydroxy-7-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC1(C)OB(c2ccc(C3(O)CC4COCC(C3)N4C(=O)OCC3c4ccccc4-c4ccccc43)nc2)OC1(C)C |
| InChI | InChI=1S/C33H37BN2O6/c1-31(2)32(3,4)42-34(41-31)21-13-14-29(35-17-21)33(38)15-22-18-39-19-23(16-33)36(22)30(37)40-20-28-26-11-7-5-9-24(26)25-10-6-8-12-27(25)28/h5-14,17,22-23,28,38H,15-16,18-20H2,1-4H3 |
| InChIKey | ZWKMOZZQXCUPEH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|