C15H15F5O3S — CID 171953820
8-oxo-3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171953820) has the molecular formula C15H15F5O3S and a molecular weight of 370.34 g/mol. Its IUPAC name is 8-oxo-3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-8λ4-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-oxo-3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-8λ4-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171953820 |
| Molecular Formula | C15H15F5O3S |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 8-oxo-3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1C2CCC1CC(O)(c1ccc(OC(F)(F)C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C15H15F5O3S/c16-14(17,18)15(19,20)23-10-3-1-9(2-4-10)13(21)7-11-5-6-12(8-13)24(11)22/h1-4,11-12,21H,5-8H2 |
| InChIKey | ZRZAJBUKWXEXQC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|