About 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile
4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile (PubChem CID 171954046) has the molecular formula C14H13F2NO3S
and a molecular weight of 313.32 g/mol. Its IUPAC name is 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile.
Molecular Properties
| Compound Name | 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile |
| PubChem CID | 171954046 |
| Molecular Formula | C14H13F2NO3S |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile |
| SMILES | N#Cc1cc(F)c(F)cc1C1(O)CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C14H13F2NO3S/c15-12-3-8(7-17)11(4-13(12)16)14(18)5-9-1-2-10(6-14)21(9,19)20/h3-4,9-10,18H,1-2,5-6H2 |
| InChIKey | DFEGBTYSUFVRDK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile?
The IUPAC name of 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile (CID 171954046) is 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile.
What is the SMILES notation for 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile?
The canonical SMILES for 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile is N#Cc1cc(F)c(F)cc1C1(O)CC2CCC(C1)S2(=O)=O.
What is the InChIKey of 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile?
The InChIKey is DFEGBTYSUFVRDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NO3S/c15-12-3-8(7-17)11(4-13(12)16)14(18)5-9-1-2-10(6-14)21(9,19)20/h3-4,9-10,18H,1-2,5-6H2.
What are the key properties of 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile?
4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile has a molecular weight of 313.32 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluoro-2-(3-hydroxy-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)benzonitrile is sourced from PubChem (CID 171954046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).