About 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile
4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile (PubChem CID 171954054) has the molecular formula C15H15F2NO2S
and a molecular weight of 311.35 g/mol. Its IUPAC name is 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile.
Molecular Properties
| Compound Name | 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile |
| PubChem CID | 171954054 |
| Molecular Formula | C15H15F2NO2S |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile |
| SMILES | N#Cc1cc(F)c(F)cc1C1(O)CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C15H15F2NO2S/c16-13-4-9(8-18)12(5-14(13)17)15(19)6-10-2-1-3-11(7-15)21(10)20/h4-5,10-11,19H,1-3,6-7H2 |
| InChIKey | MJRIYJWLRHLTBN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile?
The IUPAC name of 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile (CID 171954054) is 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile.
What is the SMILES notation for 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile?
The canonical SMILES for 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile is N#Cc1cc(F)c(F)cc1C1(O)CC2CCCC(C1)S2=O.
What is the InChIKey of 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile?
The InChIKey is MJRIYJWLRHLTBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2NO2S/c16-13-4-9(8-18)12(5-14(13)17)15(19)6-10-2-1-3-11(7-15)21(10)20/h4-5,10-11,19H,1-3,6-7H2.
What are the key properties of 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile?
4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile has a molecular weight of 311.35 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluoro-2-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)benzonitrile is sourced from PubChem (CID 171954054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).