About 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile
4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile (PubChem CID 171954112) has the molecular formula C16H20N2O
and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile |
| PubChem CID | 171954112 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1C1(O)CC2CCC(C1)N2 |
| InChI | InChI=1S/C16H20N2O/c1-10-5-12(9-17)6-11(2)15(10)16(19)7-13-3-4-14(8-16)18-13/h5-6,13-14,18-19H,3-4,7-8H2,1-2H3 |
| InChIKey | KBBYZCPNCQIAJI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile?
The IUPAC name of 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile (CID 171954112) is 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C)c1C1(O)CC2CCC(C1)N2.
What is the InChIKey of 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile?
The InChIKey is KBBYZCPNCQIAJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O/c1-10-5-12(9-17)6-11(2)15(10)16(19)7-13-3-4-14(8-16)18-13/h5-6,13-14,18-19H,3-4,7-8H2,1-2H3.
What are the key properties of 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile?
4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile has a molecular weight of 256.35 g/mol, XLogP of 2.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-hydroxy-8-azabicyclo[3.2.1]octan-3-yl)-3,5-dimethylbenzonitrile is sourced from PubChem (CID 171954112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).