About 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol
9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171954454) has the molecular formula C14H16F3NO3S
and a molecular weight of 335.35 g/mol. Its IUPAC name is 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol.
Molecular Properties
| Compound Name | 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
| PubChem CID | 171954454 |
| Molecular Formula | C14H16F3NO3S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | O=S1(=O)C2CCCC1CC(O)(c1cccc(C(F)(F)F)n1)C2 |
| InChI | InChI=1S/C14H16F3NO3S/c15-14(16,17)12-6-2-5-11(18-12)13(19)7-9-3-1-4-10(8-13)22(9,20)21/h2,5-6,9-10,19H,1,3-4,7-8H2 |
| InChIKey | XJUINLNNSQNVAZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol?
The IUPAC name of 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol (CID 171954454) is 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol.
What is the SMILES notation for 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol?
The canonical SMILES for 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol is O=S1(=O)C2CCCC1CC(O)(c1cccc(C(F)(F)F)n1)C2.
What is the InChIKey of 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol?
The InChIKey is XJUINLNNSQNVAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3NO3S/c15-14(16,17)12-6-2-5-11(18-12)13(19)7-9-3-1-4-10(8-13)22(9,20)21/h2,5-6,9-10,19H,1,3-4,7-8H2.
What are the key properties of 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol?
9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol has a molecular weight of 335.35 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dioxo-3-[6-(trifluoromethyl)-2-pyridinyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol is sourced from PubChem (CID 171954454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).