C21H30FNO4 — CID 171955019
tert-butyl 3-[2-(4-fluorophenoxy)ethyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171955019) has the molecular formula C21H30FNO4 and a molecular weight of 379.47 g/mol. Its IUPAC name is tert-butyl 3-[2-(4-fluorophenoxy)ethyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 3-[2-(4-fluorophenoxy)ethyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171955019 |
| Molecular Formula | C21H30FNO4 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | tert-butyl 3-[2-(4-fluorophenoxy)ethyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCCC1CC(O)(CCOc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C21H30FNO4/c1-20(2,3)27-19(24)23-16-5-4-6-17(23)14-21(25,13-16)11-12-26-18-9-7-15(22)8-10-18/h7-10,16-17,25H,4-6,11-14H2,1-3H3 |
| InChIKey | NWDIHCURCBXVMN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |