C16H20N2O2 — CID 171955950
3-(2-methyl-1,3-benzoxazol-5-yl)-9-azabicyclo[3.3.1]nonan-3-ol (PubChem CID 171955950) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-(2-methyl-1,3-benzoxazol-5-yl)-9-azabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(2-methyl-1,3-benzoxazol-5-yl)-9-azabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171955950 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-(2-methyl-1,3-benzoxazol-5-yl)-9-azabicyclo[3.3.1]nonan-3-ol |
| SMILES | Cc1nc2cc(C3(O)CC4CCCC(C3)N4)ccc2o1 |
| InChI | InChI=1S/C16H20N2O2/c1-10-17-14-7-11(5-6-15(14)20-10)16(19)8-12-3-2-4-13(9-16)18-12/h5-7,12-13,18-19H,2-4,8-9H2,1H3 |
| InChIKey | RWMRRGQAMCWJGL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |