C16H20N2O — CID 171956282
3-(1-methylindol-5-yl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171956282) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-(1-methylindol-5-yl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(1-methylindol-5-yl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171956282 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-(1-methylindol-5-yl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | Cn1ccc2cc(C3(O)CC4CCC(C3)N4)ccc21 |
| InChI | InChI=1S/C16H20N2O/c1-18-7-6-11-8-12(2-5-15(11)18)16(19)9-13-3-4-14(10-16)17-13/h2,5-8,13-14,17,19H,3-4,9-10H2,1H3 |
| InChIKey | AWULMDDRQAHLPR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |