About 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol
8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171956759) has the molecular formula C16H22O5S
and a molecular weight of 326.41 g/mol. Its IUPAC name is 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 171956759 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | COc1cc(C2(O)CC3CCC(C2)S3=O)cc(OC)c1OC |
| InChI | InChI=1S/C16H22O5S/c1-19-13-6-10(7-14(20-2)15(13)21-3)16(17)8-11-4-5-12(9-16)22(11)18/h6-7,11-12,17H,4-5,8-9H2,1-3H3 |
| InChIKey | CAZZRTPZLZLYCD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol (CID 171956759) is 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol is COc1cc(C2(O)CC3CCC(C2)S3=O)cc(OC)c1OC.
What is the InChIKey of 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The InChIKey is CAZZRTPZLZLYCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O5S/c1-19-13-6-10(7-14(20-2)15(13)21-3)16(17)8-11-4-5-12(9-16)22(11)18/h6-7,11-12,17H,4-5,8-9H2,1-3H3.
What are the key properties of 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol has a molecular weight of 326.41 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxo-3-(3,4,5-trimethoxyphenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 171956759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).