C16H19F3O2S — CID 171956892
3-[[2-(trifluoromethoxy)phenyl]methyl]-9-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171956892) has the molecular formula C16H19F3O2S and a molecular weight of 332.39 g/mol. Its IUPAC name is 3-[[2-(trifluoromethoxy)phenyl]methyl]-9-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-[[2-(trifluoromethoxy)phenyl]methyl]-9-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171956892 |
| Molecular Formula | C16H19F3O2S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 3-[[2-(trifluoromethoxy)phenyl]methyl]-9-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | OC1(Cc2ccccc2OC(F)(F)F)CC2CCCC(C1)S2 |
| InChI | InChI=1S/C16H19F3O2S/c17-16(18,19)21-14-7-2-1-4-11(14)8-15(20)9-12-5-3-6-13(10-15)22-12/h1-2,4,7,12-13,20H,3,5-6,8-10H2 |
| InChIKey | HMBUWFPMLATQFN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |