About 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile
5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile (PubChem CID 171958319) has the molecular formula C13H14N2O2S
and a molecular weight of 262.33 g/mol. Its IUPAC name is 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile |
| PubChem CID | 171958319 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(C2(O)CC3CCC(C2)S3=O)cn1 |
| InChI | InChI=1S/C13H14N2O2S/c14-7-10-2-1-9(8-15-10)13(16)5-11-3-4-12(6-13)18(11)17/h1-2,8,11-12,16H,3-6H2 |
| InChIKey | AJIROINNXSGORZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile?
The IUPAC name of 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile (CID 171958319) is 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile.
What is the SMILES notation for 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile?
The canonical SMILES for 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile is N#Cc1ccc(C2(O)CC3CCC(C2)S3=O)cn1.
What is the InChIKey of 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile?
The InChIKey is AJIROINNXSGORZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2S/c14-7-10-2-1-9(8-15-10)13(16)5-11-3-4-12(6-13)18(11)17/h1-2,8,11-12,16H,3-6H2.
What are the key properties of 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile?
5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile has a molecular weight of 262.33 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-hydroxy-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)pyridine-2-carbonitrile is sourced from PubChem (CID 171958319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).