C20H21F2NO2 — CID 171958520
9-benzyl-7-(3,5-difluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol (PubChem CID 171958520) has the molecular formula C20H21F2NO2 and a molecular weight of 345.39 g/mol. Its IUPAC name is 9-benzyl-7-(3,5-difluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol.
| Compound Name | 9-benzyl-7-(3,5-difluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
|---|---|
| PubChem CID | 171958520 |
| Molecular Formula | C20H21F2NO2 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 9-benzyl-7-(3,5-difluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
| SMILES | OC1(c2cc(F)cc(F)c2)CC2COCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C20H21F2NO2/c21-16-6-15(7-17(22)8-16)20(24)9-18-12-25-13-19(10-20)23(18)11-14-4-2-1-3-5-14/h1-8,18-19,24H,9-13H2 |
| InChIKey | GKMHKFGWGAMYBZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |