About 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol
3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171959861) has the molecular formula C15H17NO3S
and a molecular weight of 291.37 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
Molecular Properties
| Compound Name | 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| PubChem CID | 171959861 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | O=S1C2CCCC1CC(O)(c1ccc3ocnc3c1)C2 |
| InChI | InChI=1S/C15H17NO3S/c17-15(7-11-2-1-3-12(8-15)20(11)18)10-4-5-14-13(6-10)16-9-19-14/h4-6,9,11-12,17H,1-3,7-8H2 |
| InChIKey | FVEWHCKPBILSEL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The IUPAC name of 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol (CID 171959861) is 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
What is the SMILES notation for 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The canonical SMILES for 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol is O=S1C2CCCC1CC(O)(c1ccc3ocnc3c1)C2.
What is the InChIKey of 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The InChIKey is FVEWHCKPBILSEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3S/c17-15(7-11-2-1-3-12(8-15)20(11)18)10-4-5-14-13(6-10)16-9-19-14/h4-6,9,11-12,17H,1-3,7-8H2.
What are the key properties of 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol has a molecular weight of 291.37 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzoxazol-5-yl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol is sourced from PubChem (CID 171959861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).