C20H23N3O4 — CID 17196099
4-[(4-nitrobenzoyl)amino]-N,N-dipropylbenzamide (PubChem CID 17196099) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-[(4-nitrobenzoyl)amino]-N,N-dipropylbenzamide.
| Compound Name | 4-[(4-nitrobenzoyl)amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 17196099 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-[(4-nitrobenzoyl)amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H23N3O4/c1-3-13-22(14-4-2)20(25)16-5-9-17(10-6-16)21-19(24)15-7-11-18(12-8-15)23(26)27/h5-12H,3-4,13-14H2,1-2H3,(H,21,24) |
| InChIKey | ZDPZDNJNTIRCMD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|