C20H28FNO4 — CID 171961448
tert-butyl 3-(4-fluoro-3-methoxyphenyl)-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171961448) has the molecular formula C20H28FNO4 and a molecular weight of 365.45 g/mol. Its IUPAC name is tert-butyl 3-(4-fluoro-3-methoxyphenyl)-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 3-(4-fluoro-3-methoxyphenyl)-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171961448 |
| Molecular Formula | C20H28FNO4 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | tert-butyl 3-(4-fluoro-3-methoxyphenyl)-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | COc1cc(C2(O)CC3CCCC(C2)N3C(=O)OC(C)(C)C)ccc1F |
| InChI | InChI=1S/C20H28FNO4/c1-19(2,3)26-18(23)22-14-6-5-7-15(22)12-20(24,11-14)13-8-9-16(21)17(10-13)25-4/h8-10,14-15,24H,5-7,11-12H2,1-4H3 |
| InChIKey | ZPGAHQXUNWVULT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |