C15H19F2NO — CID 171961833
3-(2,4-difluoro-5-methylphenyl)-9-azabicyclo[3.3.1]nonan-3-ol (PubChem CID 171961833) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-(2,4-difluoro-5-methylphenyl)-9-azabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(2,4-difluoro-5-methylphenyl)-9-azabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171961833 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-(2,4-difluoro-5-methylphenyl)-9-azabicyclo[3.3.1]nonan-3-ol |
| SMILES | Cc1cc(C2(O)CC3CCCC(C2)N3)c(F)cc1F |
| InChI | InChI=1S/C15H19F2NO/c1-9-5-12(14(17)6-13(9)16)15(19)7-10-3-2-4-11(8-15)18-10/h5-6,10-11,18-19H,2-4,7-8H2,1H3 |
| InChIKey | MYJDQXRUOAWCNT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |