About 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol
3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171962136) has the molecular formula C17H24O2S
and a molecular weight of 292.44 g/mol. Its IUPAC name is 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
Molecular Properties
| Compound Name | 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| PubChem CID | 171962136 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | Cc1cccc(C)c1CC1(O)CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C17H24O2S/c1-12-5-3-6-13(2)16(12)11-17(18)9-14-7-4-8-15(10-17)20(14)19/h3,5-6,14-15,18H,4,7-11H2,1-2H3 |
| InChIKey | YIVAQNDUVXJLGP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The IUPAC name of 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol (CID 171962136) is 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
What is the SMILES notation for 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The canonical SMILES for 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol is Cc1cccc(C)c1CC1(O)CC2CCCC(C1)S2=O.
What is the InChIKey of 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
The InChIKey is YIVAQNDUVXJLGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O2S/c1-12-5-3-6-13(2)16(12)11-17(18)9-14-7-4-8-15(10-17)20(14)19/h3,5-6,14-15,18H,4,7-11H2,1-2H3.
What are the key properties of 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol?
3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol has a molecular weight of 292.44 g/mol, XLogP of 3.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dimethylphenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol is sourced from PubChem (CID 171962136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).