About 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol
3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171962161) has the molecular formula C17H24O3S
and a molecular weight of 308.44 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol.
Molecular Properties
| Compound Name | 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
| PubChem CID | 171962161 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | Cc1cc(C)cc(CC2(O)CC3CCCC(C2)S3(=O)=O)c1 |
| InChI | InChI=1S/C17H24O3S/c1-12-6-13(2)8-14(7-12)9-17(18)10-15-4-3-5-16(11-17)21(15,19)20/h6-8,15-16,18H,3-5,9-11H2,1-2H3 |
| InChIKey | XODJWNLRLPBSLE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol?
The IUPAC name of 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol (CID 171962161) is 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol.
What is the SMILES notation for 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol?
The canonical SMILES for 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol is Cc1cc(C)cc(CC2(O)CC3CCCC(C2)S3(=O)=O)c1.
What is the InChIKey of 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol?
The InChIKey is XODJWNLRLPBSLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O3S/c1-12-6-13(2)8-14(7-12)9-17(18)10-15-4-3-5-16(11-17)21(15,19)20/h6-8,15-16,18H,3-5,9-11H2,1-2H3.
What are the key properties of 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol?
3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol has a molecular weight of 308.44 g/mol, XLogP of 2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethylphenyl)methyl]-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol is sourced from PubChem (CID 171962161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).