C22H22F3NO3 — CID 171962455
benzyl 3-hydroxy-3-(3,4,5-trifluorophenyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171962455) has the molecular formula C22H22F3NO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is benzyl 3-hydroxy-3-(3,4,5-trifluorophenyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 3-hydroxy-3-(3,4,5-trifluorophenyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171962455 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | benzyl 3-hydroxy-3-(3,4,5-trifluorophenyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2CCCC1CC(O)(c1cc(F)c(F)c(F)c1)C2 |
| InChI | InChI=1S/C22H22F3NO3/c23-18-9-15(10-19(24)20(18)25)22(28)11-16-7-4-8-17(12-22)26(16)21(27)29-13-14-5-2-1-3-6-14/h1-3,5-6,9-10,16-17,28H,4,7-8,11-13H2 |
| InChIKey | OYWVXUQFDJZVCD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|