C32H35NO5 — CID 171963597
9H-fluoren-9-ylmethyl 3-[2-(dimethoxymethyl)phenyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171963597) has the molecular formula C32H35NO5 and a molecular weight of 513.63 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-[2-(dimethoxymethyl)phenyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-[2-(dimethoxymethyl)phenyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171963597 |
| Molecular Formula | C32H35NO5 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-[2-(dimethoxymethyl)phenyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | COC(OC)c1ccccc1C1(O)CC2CCCC(C1)N2C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H35NO5/c1-36-30(37-2)27-16-7-8-17-29(27)32(35)18-21-10-9-11-22(19-32)33(21)31(34)38-20-28-25-14-5-3-12-23(25)24-13-4-6-15-26(24)28/h3-8,12-17,21-22,28,30,35H,9-11,18-20H2,1-2H3 |
| InChIKey | IVZTUMUSFUTWQQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|