C14H13F5O2S — CID 171963922
9-oxo-3-(2,3,4,5,6-pentafluorophenyl)-9λ4-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171963922) has the molecular formula C14H13F5O2S and a molecular weight of 340.31 g/mol. Its IUPAC name is 9-oxo-3-(2,3,4,5,6-pentafluorophenyl)-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 9-oxo-3-(2,3,4,5,6-pentafluorophenyl)-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171963922 |
| Molecular Formula | C14H13F5O2S |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 9-oxo-3-(2,3,4,5,6-pentafluorophenyl)-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | O=S1C2CCCC1CC(O)(c1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C14H13F5O2S/c15-9-8(10(16)12(18)13(19)11(9)17)14(20)4-6-2-1-3-7(5-14)22(6)21/h6-7,20H,1-5H2 |
| InChIKey | CBPBODFLMJWGKU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|