C18H20F5NO4 — CID 171963928
tert-butyl 7-hydroxy-7-(2,3,4,5,6-pentafluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171963928) has the molecular formula C18H20F5NO4 and a molecular weight of 409.35 g/mol. Its IUPAC name is tert-butyl 7-hydroxy-7-(2,3,4,5,6-pentafluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 7-hydroxy-7-(2,3,4,5,6-pentafluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171963928 |
| Molecular Formula | C18H20F5NO4 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | tert-butyl 7-hydroxy-7-(2,3,4,5,6-pentafluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2COCC1CC(O)(c1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C18H20F5NO4/c1-17(2,3)28-16(25)24-8-4-18(26,5-9(24)7-27-6-8)10-11(19)13(21)15(23)14(22)12(10)20/h8-9,26H,4-7H2,1-3H3 |
| InChIKey | ANYZWBITJQPFEX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|