About 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol
3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171963963) has the molecular formula C15H17F3O3S
and a molecular weight of 334.36 g/mol. Its IUPAC name is 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 171963963 |
| Molecular Formula | C15H17F3O3S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | Cc1ccc(C(F)(F)F)cc1C1(O)CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C15H17F3O3S/c1-9-2-3-10(15(16,17)18)6-13(9)14(19)7-11-4-5-12(8-14)22(11,20)21/h2-3,6,11-12,19H,4-5,7-8H2,1H3 |
| InChIKey | DSPPBOBDEKRUAV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol (CID 171963963) is 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol is Cc1ccc(C(F)(F)F)cc1C1(O)CC2CCC(C1)S2(=O)=O.
What is the InChIKey of 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
The InChIKey is DSPPBOBDEKRUAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F3O3S/c1-9-2-3-10(15(16,17)18)6-13(9)14(19)7-11-4-5-12(8-14)22(11,20)21/h2-3,6,11-12,19H,4-5,7-8H2,1H3.
What are the key properties of 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol?
3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol has a molecular weight of 334.36 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-methyl-5-(trifluoromethyl)phenyl]-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 171963963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).