C27H33NO5 — CID 171964180
9H-fluoren-9-ylmethyl 3-(2,2-dimethoxypropyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171964180) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-(2,2-dimethoxypropyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-(2,2-dimethoxypropyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171964180 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-(2,2-dimethoxypropyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COC(C)(CC1(O)CC2CCC(C1)N2C(=O)OCC1c2ccccc2-c2ccccc21)OC |
| InChI | InChI=1S/C27H33NO5/c1-26(31-2,32-3)17-27(30)14-18-12-13-19(15-27)28(18)25(29)33-16-24-22-10-6-4-8-20(22)21-9-5-7-11-23(21)24/h4-11,18-19,24,30H,12-17H2,1-3H3 |
| InChIKey | JCJWAQRNOLHEBT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|