About 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol
8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171964308) has the molecular formula C11H17F3O2S
and a molecular weight of 270.32 g/mol. Its IUPAC name is 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 171964308 |
| Molecular Formula | C11H17F3O2S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1C2CCC1CC(O)(CCCC(F)(F)F)C2 |
| InChI | InChI=1S/C11H17F3O2S/c12-11(13,14)5-1-4-10(15)6-8-2-3-9(7-10)17(8)16/h8-9,15H,1-7H2 |
| InChIKey | SICSIHCLNMAACX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol (CID 171964308) is 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol is O=S1C2CCC1CC(O)(CCCC(F)(F)F)C2.
What is the InChIKey of 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
The InChIKey is SICSIHCLNMAACX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3O2S/c12-11(13,14)5-1-4-10(15)6-8-2-3-9(7-10)17(8)16/h8-9,15H,1-7H2.
What are the key properties of 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol?
8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol has a molecular weight of 270.32 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxo-3-(4,4,4-trifluorobutyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 171964308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).