C24H25NO4 — CID 171967753
tert-butyl 7-dibenzofuran-2-yl-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171967753) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is tert-butyl 7-dibenzofuran-2-yl-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | tert-butyl 7-dibenzofuran-2-yl-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171967753 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | tert-butyl 7-dibenzofuran-2-yl-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(c3ccc4oc5ccccc5c4c3)CC1COC2 |
| InChI | InChI=1S/C24H25NO4/c1-24(2,3)29-23(26)25-17-10-16(11-18(25)14-27-13-17)15-8-9-22-20(12-15)19-6-4-5-7-21(19)28-22/h4-10,12,17-18H,11,13-14H2,1-3H3 |
| InChIKey | UATVPJLHWQAXFL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |