C22H20FNO3 — CID 171969011
benzyl 3-(5-fluoro-2-formylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171969011) has the molecular formula C22H20FNO3 and a molecular weight of 365.40 g/mol. Its IUPAC name is benzyl 3-(5-fluoro-2-formylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | benzyl 3-(5-fluoro-2-formylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171969011 |
| Molecular Formula | C22H20FNO3 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | benzyl 3-(5-fluoro-2-formylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | O=Cc1ccc(F)cc1C1=CC2CCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H20FNO3/c23-18-7-6-16(13-25)21(12-18)17-10-19-8-9-20(11-17)24(19)22(26)27-14-15-4-2-1-3-5-15/h1-7,10,12-13,19-20H,8-9,11,14H2 |
| InChIKey | NKUFIOFCRZGSSP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|