C22H22ClNO2 — CID 171969656
5-(9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-yl)-2-chlorobenzoic acid (PubChem CID 171969656) has the molecular formula C22H22ClNO2 and a molecular weight of 367.88 g/mol. Its IUPAC name is 5-(9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-yl)-2-chlorobenzoic acid.
| Compound Name | 5-(9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-yl)-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 171969656 |
| Molecular Formula | C22H22ClNO2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 5-(9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-yl)-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(C2=CC3CCCC(C2)N3Cc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C22H22ClNO2/c23-21-10-9-16(13-20(21)22(25)26)17-11-18-7-4-8-19(12-17)24(18)14-15-5-2-1-3-6-15/h1-3,5-6,9-11,13,18-19H,4,7-8,12,14H2,(H,25,26) |
| InChIKey | XPQHDCUICKQAMX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |