C20H27NO2 — CID 171972602
tert-butyl 3-(9-methyl-9-azabicyclo[3.3.1]non-2-en-3-yl)benzoate (PubChem CID 171972602) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is tert-butyl 3-(9-methyl-9-azabicyclo[3.3.1]non-2-en-3-yl)benzoate.
| Compound Name | tert-butyl 3-(9-methyl-9-azabicyclo[3.3.1]non-2-en-3-yl)benzoate |
|---|---|
| PubChem CID | 171972602 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | tert-butyl 3-(9-methyl-9-azabicyclo[3.3.1]non-2-en-3-yl)benzoate |
| SMILES | CN1C2C=C(c3cccc(C(=O)OC(C)(C)C)c3)CC1CCC2 |
| InChI | InChI=1S/C20H27NO2/c1-20(2,3)23-19(22)15-8-5-7-14(11-15)16-12-17-9-6-10-18(13-16)21(17)4/h5,7-8,11-12,17-18H,6,9-10,13H2,1-4H3 |
| InChIKey | SLBSECKUOIWDLO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |