C20H19Cl2N — CID 171972922
8-benzyl-3-(2,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 171972922) has the molecular formula C20H19Cl2N and a molecular weight of 344.29 g/mol. Its IUPAC name is 8-benzyl-3-(2,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-ene.
| Compound Name | 8-benzyl-3-(2,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 171972922 |
| Molecular Formula | C20H19Cl2N |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 8-benzyl-3-(2,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | Clc1ccc(C2=CC3CCC(C2)N3Cc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N/c21-16-6-9-19(20(22)12-16)15-10-17-7-8-18(11-15)23(17)13-14-4-2-1-3-5-14/h1-6,9-10,12,17-18H,7-8,11,13H2 |
| InChIKey | QPPCHQWDZBFSLH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |