C22H26BrN3O4S — CID 17197294
5-bromo-N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 17197294) has the molecular formula C22H26BrN3O4S and a molecular weight of 508.44 g/mol. Its IUPAC name is 5-bromo-N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | 5-bromo-N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17197294 |
| Molecular Formula | C22H26BrN3O4S |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 5-bromo-N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | CCCCNC(=O)c1cccc(NC(=S)NC(=O)c2cc(Br)ccc2OCCOC)c1 |
| InChI | InChI=1S/C22H26BrN3O4S/c1-3-4-10-24-20(27)15-6-5-7-17(13-15)25-22(31)26-21(28)18-14-16(23)8-9-19(18)30-12-11-29-2/h5-9,13-14H,3-4,10-12H2,1-2H3,(H,24,27)(H2,25,26,28,31) |
| InChIKey | MDQIDKFPBKRXQU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|