About 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide
3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide (PubChem CID 171973687) has the molecular formula C15H14F4O2S
and a molecular weight of 334.33 g/mol. Its IUPAC name is 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide.
Molecular Properties
| Compound Name | 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
| PubChem CID | 171973687 |
| Molecular Formula | C15H14F4O2S |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
| SMILES | O=S1(=O)C2C=C(c3cc(F)cc(C(F)(F)F)c3)CC1CCC2 |
| InChI | InChI=1S/C15H14F4O2S/c16-12-5-9(4-11(8-12)15(17,18)19)10-6-13-2-1-3-14(7-10)22(13,20)21/h4-6,8,13-14H,1-3,7H2 |
| InChIKey | MHONMYXFKGYBGQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide?
The IUPAC name of 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide (CID 171973687) is 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide.
What is the SMILES notation for 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide?
The canonical SMILES for 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide is O=S1(=O)C2C=C(c3cc(F)cc(C(F)(F)F)c3)CC1CCC2.
What is the InChIKey of 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide?
The InChIKey is MHONMYXFKGYBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F4O2S/c16-12-5-9(4-11(8-12)15(17,18)19)10-6-13-2-1-3-14(7-10)22(13,20)21/h4-6,8,13-14H,1-3,7H2.
What are the key properties of 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide?
3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide has a molecular weight of 334.33 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-fluoro-5-(trifluoromethyl)phenyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide is sourced from PubChem (CID 171973687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).