C15H16F3NO2 — CID 171973865
9-methyl-7-[4-(trifluoromethoxy)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene (PubChem CID 171973865) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 9-methyl-7-[4-(trifluoromethoxy)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene.
| Compound Name | 9-methyl-7-[4-(trifluoromethoxy)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 171973865 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 9-methyl-7-[4-(trifluoromethoxy)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
| SMILES | CN1C2C=C(c3ccc(OC(F)(F)F)cc3)CC1COC2 |
| InChI | InChI=1S/C15H16F3NO2/c1-19-12-6-11(7-13(19)9-20-8-12)10-2-4-14(5-3-10)21-15(16,17)18/h2-6,12-13H,7-9H2,1H3 |
| InChIKey | VYTBCASBXJKTAZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |